C17H34N2O2 — CID 104968568
6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-methyl-2-(propan-2-ylamino)hexanoic acid (PubChem CID 104968568) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-methyl-2-(propan-2-ylamino)hexanoic acid.
| Compound Name | 6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-methyl-2-(propan-2-ylamino)hexanoic acid |
|---|---|
| PubChem CID | 104968568 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | 6-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-2-methyl-2-(propan-2-ylamino)hexanoic acid |
| SMILES | CC(C)NC(C)(CCCCN1[C@H](C)CCC[C@@H]1C)C(=O)O |
| InChI | InChI=1S/C17H34N2O2/c1-13(2)18-17(5,16(20)21)11-6-7-12-19-14(3)9-8-10-15(19)4/h13-15,18H,6-12H2,1-5H3,(H,20,21)/t14-,15+,17? |
| InChIKey | IIEDLVBOGWWSRL-FKEKPDDDSA-N |
| XLogP | 3.26 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|