C12H23NO2 — CID 28972400
5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentanoic acid (PubChem CID 28972400) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentanoic acid.
| Compound Name | 5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 28972400 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentanoic acid |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCCCC(=O)O |
| InChI | InChI=1S/C12H23NO2/c1-10-6-5-7-11(2)13(10)9-4-3-8-12(14)15/h10-11H,3-9H2,1-2H3,(H,14,15)/t10-,11+ |
| InChIKey | CNPOZTJTZKWFLL-PHIMTYICSA-N |
| XLogP | 2.50 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|