C13H27N — CID 6428887
1-hexyl-2,6-dimethylpiperidine (PubChem CID 6428887) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is 1-hexyl-2,6-dimethylpiperidine.
| Compound Name | 1-hexyl-2,6-dimethylpiperidine |
|---|---|
| PubChem CID | 6428887 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | 1-hexyl-2,6-dimethylpiperidine |
| SMILES | CCCCCCN1C(C)CCCC1C |
| InChI | InChI=1S/C13H27N/c1-4-5-6-7-11-14-12(2)9-8-10-13(14)3/h12-13H,4-11H2,1-3H3 |
| InChIKey | ZBHRMBBPOGDWJG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|