C11H24N2 — CID 61386862
3-(2,6-dimethylpiperidin-1-yl)-N-methylpropan-1-amine (PubChem CID 61386862) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 3-(2,6-dimethylpiperidin-1-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(2,6-dimethylpiperidin-1-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 61386862 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 3-(2,6-dimethylpiperidin-1-yl)-N-methylpropan-1-amine |
| SMILES | CNCCCN1C(C)CCCC1C |
| InChI | InChI=1S/C11H24N2/c1-10-6-4-7-11(2)13(10)9-5-8-12-3/h10-12H,4-9H2,1-3H3 |
| InChIKey | UTQJTOOEIZYMOC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|