C11H23N3O — CID 24711265
4-(2,6-dimethylpiperidin-1-yl)-N'-hydroxybutanimidamide (PubChem CID 24711265) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 4-(2,6-dimethylpiperidin-1-yl)-N'-hydroxybutanimidamide.
| Compound Name | 4-(2,6-dimethylpiperidin-1-yl)-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 24711265 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 4-(2,6-dimethylpiperidin-1-yl)-N'-hydroxybutanimidamide |
| SMILES | CC1CCCC(C)N1CCC/C(N)=N/O |
| InChI | InChI=1S/C11H23N3O/c1-9-5-3-6-10(2)14(9)8-4-7-11(12)13-15/h9-10,15H,3-8H2,1-2H3,(H2,12,13) |
| InChIKey | KHZPYQKIQZHQSN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|