C11H23NO — CID 19867661
4-(2,6-dimethylpiperidin-1-yl)butan-1-ol (PubChem CID 19867661) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is 4-(2,6-dimethylpiperidin-1-yl)butan-1-ol.
| Compound Name | 4-(2,6-dimethylpiperidin-1-yl)butan-1-ol |
|---|---|
| PubChem CID | 19867661 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 4-(2,6-dimethylpiperidin-1-yl)butan-1-ol |
| SMILES | CC1CCCC(C)N1CCCCO |
| InChI | InChI=1S/C11H23NO/c1-10-6-5-7-11(2)12(10)8-3-4-9-13/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | PXKHKDPKKROFIS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|