C10H20N2O — CID 92917685
3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propanamide (PubChem CID 92917685) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propanamide.
| Compound Name | 3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 92917685 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 3-[(2S,6R)-2,6-dimethylpiperidin-1-yl]propanamide |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCC(N)=O |
| InChI | InChI=1S/C10H20N2O/c1-8-4-3-5-9(2)12(8)7-6-10(11)13/h8-9H,3-7H2,1-2H3,(H2,11,13)/t8-,9+ |
| InChIKey | NQLAPIWJYJBOTD-DTORHVGOSA-N |
| XLogP | 1.12 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |