C9H17NO2 — CID 91351477
2-(2,6-dimethyl(213C)azinan-1-yl)acetic acid (PubChem CID 91351477) has the molecular formula C9H17NO2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-(2,6-dimethyl(213C)azinan-1-yl)acetic acid.
| Compound Name | 2-(2,6-dimethyl(213C)azinan-1-yl)acetic acid |
|---|---|
| PubChem CID | 91351477 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 2-(2,6-dimethyl(213C)azinan-1-yl)acetic acid |
| SMILES | CC1CCC[13CH](C)N1CC(=O)O |
| InChI | InChI=1S/C9H17NO2/c1-7-4-3-5-8(2)10(7)6-9(11)12/h7-8H,3-6H2,1-2H3,(H,11,12)/i7+1 |
| InChIKey | YLBXXWPPZXGSJT-CDYZYAPPSA-N |
| XLogP | 1.33 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |