C10H20N2O — CID 59404509
2-(2,6-dimethylpiperidin-1-yl)-N-methylacetamide (PubChem CID 59404509) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-(2,6-dimethylpiperidin-1-yl)-N-methylacetamide.
| Compound Name | 2-(2,6-dimethylpiperidin-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 59404509 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 2-(2,6-dimethylpiperidin-1-yl)-N-methylacetamide |
| SMILES | CNC(=O)CN1C(C)CCCC1C |
| InChI | InChI=1S/C10H20N2O/c1-8-5-4-6-9(2)12(8)7-10(13)11-3/h8-9H,4-7H2,1-3H3,(H,11,13) |
| InChIKey | IFWJZECJHRBYIP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |