C9H18N2O2 — CID 131155453
2-(2,5-dimethylpyrrolidin-1-yl)-N-methoxyacetamide (PubChem CID 131155453) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrolidin-1-yl)-N-methoxyacetamide.
| Compound Name | 2-(2,5-dimethylpyrrolidin-1-yl)-N-methoxyacetamide |
|---|---|
| PubChem CID | 131155453 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-(2,5-dimethylpyrrolidin-1-yl)-N-methoxyacetamide |
| SMILES | CONC(=O)CN1C(C)CCC1C |
| InChI | InChI=1S/C9H18N2O2/c1-7-4-5-8(2)11(7)6-9(12)10-13-3/h7-8H,4-6H2,1-3H3,(H,10,12) |
| InChIKey | JSPNBUBFKONZRO-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|