2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]acetic acid

C11H20N2O3 — CID 59404491

IUPAC2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]acetic acid
SMILESCC1CCCC(C)N1CC(=O)NCC(=O)O
InChIInChI=1S/C11H20N2O3/c1-8-4-3-5-9(2)13(8)7-10(14)12-6-11(15)16/h8-9H,3-7H2,1-2H3,(H,12,14)(H,15,16)
InChIKeyCUTSLQQDXJJRQZ-UHFFFAOYSA-N
MW228.29 g/mol
LogP0.45
Rot. Bonds4

About 2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]acetic acid

2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]acetic acid (PubChem CID 59404491) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]acetic acid.

Molecular Properties

Compound Name2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]acetic acid
PubChem CID59404491
Molecular FormulaC11H20N2O3
Molecular Weight228.29 g/mol
Exact Mass228.15
IUPAC Name2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]acetic acid
SMILESCC1CCCC(C)N1CC(=O)NCC(=O)O
InChIInChI=1S/C11H20N2O3/c1-8-4-3-5-9(2)13(8)7-10(14)12-6-11(15)16/h8-9H,3-7H2,1-2H3,(H,12,14)(H,15,16)
InChIKeyCUTSLQQDXJJRQZ-UHFFFAOYSA-N
XLogP0.45
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.29
LogP ≤ 50.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]acetic acid?
The IUPAC name of 2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]acetic acid (CID 59404491) is 2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]acetic acid.
What is the SMILES notation for 2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]acetic acid?
The canonical SMILES for 2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]acetic acid is CC1CCCC(C)N1CC(=O)NCC(=O)O.
What is the InChIKey of 2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]acetic acid?
The InChIKey is CUTSLQQDXJJRQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3/c1-8-4-3-5-9(2)13(8)7-10(14)12-6-11(15)16/h8-9H,3-7H2,1-2H3,(H,12,14)(H,15,16).
What are the key properties of 2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]acetic acid?
2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]acetic acid has a molecular weight of 228.29 g/mol, XLogP of 0.45, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]acetic acid is sourced from PubChem (CID 59404491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).