About 3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-(4-oxohexyl)propanamide
3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-(4-oxohexyl)propanamide (PubChem CID 159541365) has the molecular formula C18H33N3O3
and a molecular weight of 339.48 g/mol. Its IUPAC name is 3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-(4-oxohexyl)propanamide.
Molecular Properties
| Compound Name | 3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-(4-oxohexyl)propanamide |
| PubChem CID | 159541365 |
| Molecular Formula | C18H33N3O3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | 3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-(4-oxohexyl)propanamide |
| SMILES | CCC(=O)CCCNC(=O)CCNC(=O)CN1C(C)CCCC1C |
| InChI | InChI=1S/C18H33N3O3/c1-4-16(22)9-6-11-19-17(23)10-12-20-18(24)13-21-14(2)7-5-8-15(21)3/h14-15H,4-13H2,1-3H3,(H,19,23)(H,20,24) |
| InChIKey | CRFNXMOVMPWCNO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-(4-oxohexyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-(4-oxohexyl)propanamide?
The IUPAC name of 3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-(4-oxohexyl)propanamide (CID 159541365) is 3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-(4-oxohexyl)propanamide.
What is the SMILES notation for 3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-(4-oxohexyl)propanamide?
The canonical SMILES for 3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-(4-oxohexyl)propanamide is CCC(=O)CCCNC(=O)CCNC(=O)CN1C(C)CCCC1C.
What is the InChIKey of 3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-(4-oxohexyl)propanamide?
The InChIKey is CRFNXMOVMPWCNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33N3O3/c1-4-16(22)9-6-11-19-17(23)10-12-20-18(24)13-21-14(2)7-5-8-15(21)3/h14-15H,4-13H2,1-3H3,(H,19,23)(H,20,24).
What are the key properties of 3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-(4-oxohexyl)propanamide?
3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-(4-oxohexyl)propanamide has a molecular weight of 339.48 g/mol, XLogP of 1.63, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-(4-oxohexyl)propanamide is sourced from PubChem (CID 159541365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).