C22H36N4O6 — CID 123990635
(2,5-dihydroxypyrrol-1-yl) 6-[3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]propanoylamino]hexanoate (PubChem CID 123990635) has the molecular formula C22H36N4O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-[3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]propanoylamino]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-[3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]propanoylamino]hexanoate |
|---|---|
| PubChem CID | 123990635 |
| Molecular Formula | C22H36N4O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-[3-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]propanoylamino]hexanoate |
| SMILES | CC1CCCC(C)N1CC(=O)NCCC(=O)NCCCCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C22H36N4O6/c1-16-7-6-8-17(2)25(16)15-19(28)24-14-12-18(27)23-13-5-3-4-9-22(31)32-26-20(29)10-11-21(26)30/h10-11,16-17,29-30H,3-9,12-15H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | MREWKQRXKUVPHJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|