About 2-(2,5-dimethylpyrrolidin-1-yl)-N,N-dimethylacetamide
2-(2,5-dimethylpyrrolidin-1-yl)-N,N-dimethylacetamide (PubChem CID 126990033) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrolidin-1-yl)-N,N-dimethylacetamide.
Analyze 2-(2,5-dimethylpyrrolidin-1-yl)-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylpyrrolidin-1-yl)-N,N-dimethylacetamide?
The IUPAC name of 2-(2,5-dimethylpyrrolidin-1-yl)-N,N-dimethylacetamide (CID 126990033) is 2-(2,5-dimethylpyrrolidin-1-yl)-N,N-dimethylacetamide.
What is the SMILES notation for 2-(2,5-dimethylpyrrolidin-1-yl)-N,N-dimethylacetamide?
The canonical SMILES for 2-(2,5-dimethylpyrrolidin-1-yl)-N,N-dimethylacetamide is CC1CCC(C)N1CC(=O)N(C)C.
What is the InChIKey of 2-(2,5-dimethylpyrrolidin-1-yl)-N,N-dimethylacetamide?
The InChIKey is ILMRCDVFAQGTGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-8-5-6-9(2)12(8)7-10(13)11(3)4/h8-9H,5-7H2,1-4H3.
What are the key properties of 2-(2,5-dimethylpyrrolidin-1-yl)-N,N-dimethylacetamide?
2-(2,5-dimethylpyrrolidin-1-yl)-N,N-dimethylacetamide has a molecular weight of 184.28 g/mol, XLogP of 0.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylpyrrolidin-1-yl)-N,N-dimethylacetamide is sourced from PubChem (CID 126990033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).