C12H26N2O — CID 145317125
N,N-dimethyl-2-(4-methylpiperidin-1-yl)acetamide;ethane (PubChem CID 145317125) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is N,N-dimethyl-2-(4-methylpiperidin-1-yl)acetamide;ethane.
| Compound Name | N,N-dimethyl-2-(4-methylpiperidin-1-yl)acetamide;ethane |
|---|---|
| PubChem CID | 145317125 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | N,N-dimethyl-2-(4-methylpiperidin-1-yl)acetamide;ethane |
| SMILES | CC.CC1CCN(CC(=O)N(C)C)CC1 |
| InChI | InChI=1S/C10H20N2O.C2H6/c1-9-4-6-12(7-5-9)8-10(13)11(2)3;1-2/h9H,4-8H2,1-3H3;1-2H3 |
| InChIKey | RCVCIAGQDWAYNM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |