C10H21N3O — CID 127011721
2-(4-aminoazepan-1-yl)-N,N-dimethylacetamide (PubChem CID 127011721) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 2-(4-aminoazepan-1-yl)-N,N-dimethylacetamide.
| Compound Name | 2-(4-aminoazepan-1-yl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 127011721 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 2-(4-aminoazepan-1-yl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCCC(N)CC1 |
| InChI | InChI=1S/C10H21N3O/c1-12(2)10(14)8-13-6-3-4-9(11)5-7-13/h9H,3-8,11H2,1-2H3 |
| InChIKey | MXYMWEIGJGAWHH-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |