C10H18N2O — CID 130727537
1-(aziridin-1-yl)-2-(2,5-dimethylpyrrolidin-1-yl)ethanone (PubChem CID 130727537) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 1-(aziridin-1-yl)-2-(2,5-dimethylpyrrolidin-1-yl)ethanone.
| Compound Name | 1-(aziridin-1-yl)-2-(2,5-dimethylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 130727537 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 1-(aziridin-1-yl)-2-(2,5-dimethylpyrrolidin-1-yl)ethanone |
| SMILES | CC1CCC(C)N1CC(=O)N1CC1 |
| InChI | InChI=1S/C10H18N2O/c1-8-3-4-9(2)12(8)7-10(13)11-5-6-11/h8-9H,3-7H2,1-2H3 |
| InChIKey | KFSNBTUPKFJKLU-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|