About ethane;2-[4-(3-hydroxypropyl)-2,6-dimethylpiperazin-1-yl]-1-(4-methylpiperazin-1-yl)ethanone
ethane;2-[4-(3-hydroxypropyl)-2,6-dimethylpiperazin-1-yl]-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 170569075) has the molecular formula C18H38N4O2
and a molecular weight of 342.53 g/mol. Its IUPAC name is ethane;2-[4-(3-hydroxypropyl)-2,6-dimethylpiperazin-1-yl]-1-(4-methylpiperazin-1-yl)ethanone.
Molecular Properties
| Compound Name | ethane;2-[4-(3-hydroxypropyl)-2,6-dimethylpiperazin-1-yl]-1-(4-methylpiperazin-1-yl)ethanone |
| PubChem CID | 170569075 |
| Molecular Formula | C18H38N4O2 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | ethane;2-[4-(3-hydroxypropyl)-2,6-dimethylpiperazin-1-yl]-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CC.CC1CN(CCCO)CC(C)N1CC(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C16H32N4O2.C2H6/c1-14-11-18(5-4-10-21)12-15(2)20(14)13-16(22)19-8-6-17(3)7-9-19;1-2/h14-15,21H,4-13H2,1-3H3;1-2H3 |
| InChIKey | LWJIGZWGKACQAG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;2-[4-(3-hydroxypropyl)-2,6-dimethylpiperazin-1-yl]-1-(4-methylpiperazin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[4-(3-hydroxypropyl)-2,6-dimethylpiperazin-1-yl]-1-(4-methylpiperazin-1-yl)ethanone?
The IUPAC name of ethane;2-[4-(3-hydroxypropyl)-2,6-dimethylpiperazin-1-yl]-1-(4-methylpiperazin-1-yl)ethanone (CID 170569075) is ethane;2-[4-(3-hydroxypropyl)-2,6-dimethylpiperazin-1-yl]-1-(4-methylpiperazin-1-yl)ethanone.
What is the SMILES notation for ethane;2-[4-(3-hydroxypropyl)-2,6-dimethylpiperazin-1-yl]-1-(4-methylpiperazin-1-yl)ethanone?
The canonical SMILES for ethane;2-[4-(3-hydroxypropyl)-2,6-dimethylpiperazin-1-yl]-1-(4-methylpiperazin-1-yl)ethanone is CC.CC1CN(CCCO)CC(C)N1CC(=O)N1CCN(C)CC1.
What is the InChIKey of ethane;2-[4-(3-hydroxypropyl)-2,6-dimethylpiperazin-1-yl]-1-(4-methylpiperazin-1-yl)ethanone?
The InChIKey is LWJIGZWGKACQAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N4O2.C2H6/c1-14-11-18(5-4-10-21)12-15(2)20(14)13-16(22)19-8-6-17(3)7-9-19;1-2/h14-15,21H,4-13H2,1-3H3;1-2H3.
What are the key properties of ethane;2-[4-(3-hydroxypropyl)-2,6-dimethylpiperazin-1-yl]-1-(4-methylpiperazin-1-yl)ethanone?
ethane;2-[4-(3-hydroxypropyl)-2,6-dimethylpiperazin-1-yl]-1-(4-methylpiperazin-1-yl)ethanone has a molecular weight of 342.53 g/mol, XLogP of 0.56, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[4-(3-hydroxypropyl)-2,6-dimethylpiperazin-1-yl]-1-(4-methylpiperazin-1-yl)ethanone is sourced from PubChem (CID 170569075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).