C17H29N3O5 — CID 143398755
(4-oxopentanoylamino) 2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]propanoate (PubChem CID 143398755) has the molecular formula C17H29N3O5 and a molecular weight of 355.44 g/mol. Its IUPAC name is (4-oxopentanoylamino) 2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]propanoate.
| Compound Name | (4-oxopentanoylamino) 2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 143398755 |
| Molecular Formula | C17H29N3O5 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (4-oxopentanoylamino) 2-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]propanoate |
| SMILES | CC(=O)CCC(=O)NOC(=O)C(C)NC(=O)CN1C(C)CCCC1C |
| InChI | InChI=1S/C17H29N3O5/c1-11-6-5-7-12(2)20(11)10-16(23)18-14(4)17(24)25-19-15(22)9-8-13(3)21/h11-12,14H,5-10H2,1-4H3,(H,18,23)(H,19,22) |
| InChIKey | MJZAYVAERRYQJA-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|