About 1-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-hydroxyethanamine oxide
1-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-hydroxyethanamine oxide (PubChem CID 163944689) has the molecular formula C11H23N3O3
and a molecular weight of 245.32 g/mol. Its IUPAC name is 1-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-hydroxyethanamine oxide.
Molecular Properties
| Compound Name | 1-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-hydroxyethanamine oxide |
| PubChem CID | 163944689 |
| Molecular Formula | C11H23N3O3 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | 1-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-hydroxyethanamine oxide |
| SMILES | CC1CCCC(C)N1CC(=O)NC(C)[NH+]([O-])O |
| InChI | InChI=1S/C11H23N3O3/c1-8-5-4-6-9(2)13(8)7-11(15)12-10(3)14(16)17/h8-10,14,16H,4-7H2,1-3H3,(H,12,15) |
| InChIKey | RUBKPFZCVUBDSJ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 80.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-hydroxyethanamine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-hydroxyethanamine oxide?
The IUPAC name of 1-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-hydroxyethanamine oxide (CID 163944689) is 1-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-hydroxyethanamine oxide.
What is the SMILES notation for 1-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-hydroxyethanamine oxide?
The canonical SMILES for 1-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-hydroxyethanamine oxide is CC1CCCC(C)N1CC(=O)NC(C)[NH+]([O-])O.
What is the InChIKey of 1-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-hydroxyethanamine oxide?
The InChIKey is RUBKPFZCVUBDSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O3/c1-8-5-4-6-9(2)13(8)7-11(15)12-10(3)14(16)17/h8-10,14,16H,4-7H2,1-3H3,(H,12,15).
What are the key properties of 1-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-hydroxyethanamine oxide?
1-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-hydroxyethanamine oxide has a molecular weight of 245.32 g/mol, XLogP of -0.52, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(2,6-dimethylpiperidin-1-yl)acetyl]amino]-N-hydroxyethanamine oxide is sourced from PubChem (CID 163944689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).