C13H23NO2 — CID 104967846
ethyl 2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]prop-2-enoate (PubChem CID 104967846) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is ethyl 2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 104967846 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | ethyl 2-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]prop-2-enoate |
| SMILES | C=C(CN1[C@H](C)CCC[C@@H]1C)C(=O)OCC |
| InChI | InChI=1S/C13H23NO2/c1-5-16-13(15)10(2)9-14-11(3)7-6-8-12(14)4/h11-12H,2,5-9H2,1,3-4H3/t11-,12+ |
| InChIKey | HYQBFIUCFYOEKV-TXEJJXNPSA-N |
| XLogP | 2.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|