About 2-methyl-1-pentylazepane
2-methyl-1-pentylazepane (PubChem CID 134994557) has the molecular formula C12H25N
and a molecular weight of 183.34 g/mol. Its IUPAC name is 2-methyl-1-pentylazepane.
Molecular Properties
| Compound Name | 2-methyl-1-pentylazepane |
| PubChem CID | 134994557 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | 2-methyl-1-pentylazepane |
| SMILES | CCCCCN1CCCCCC1C |
| InChI | InChI=1S/C12H25N/c1-3-4-7-10-13-11-8-5-6-9-12(13)2/h12H,3-11H2,1-2H3 |
| InChIKey | OKPLSSOWOXGXOQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-pentylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-pentylazepane?
The IUPAC name of 2-methyl-1-pentylazepane (CID 134994557) is 2-methyl-1-pentylazepane.
What is the SMILES notation for 2-methyl-1-pentylazepane?
The canonical SMILES for 2-methyl-1-pentylazepane is CCCCCN1CCCCCC1C.
What is the InChIKey of 2-methyl-1-pentylazepane?
The InChIKey is OKPLSSOWOXGXOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N/c1-3-4-7-10-13-11-8-5-6-9-12(13)2/h12H,3-11H2,1-2H3.
What are the key properties of 2-methyl-1-pentylazepane?
2-methyl-1-pentylazepane has a molecular weight of 183.34 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-pentylazepane is sourced from PubChem (CID 134994557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).