About 1-butyl-2-methylpiperidine;trifluoro(trifluoromethylsulfanyl)methane
1-butyl-2-methylpiperidine;trifluoro(trifluoromethylsulfanyl)methane (PubChem CID 174970526) has the molecular formula C12H21F6NS
and a molecular weight of 325.36 g/mol. Its IUPAC name is 1-butyl-2-methylpiperidine;trifluoro(trifluoromethylsulfanyl)methane.
Molecular Properties
| Compound Name | 1-butyl-2-methylpiperidine;trifluoro(trifluoromethylsulfanyl)methane |
| PubChem CID | 174970526 |
| Molecular Formula | C12H21F6NS |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 1-butyl-2-methylpiperidine;trifluoro(trifluoromethylsulfanyl)methane |
| SMILES | CCCCN1CCCCC1C.FC(F)(F)SC(F)(F)F |
| InChI | InChI=1S/C10H21N.C2F6S/c1-3-4-8-11-9-6-5-7-10(11)2;3-1(4,5)9-2(6,7)8/h10H,3-9H2,1-2H3; |
| InChIKey | NRRGPTFIYIACNC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butyl-2-methylpiperidine;trifluoro(trifluoromethylsulfanyl)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-methylpiperidine;trifluoro(trifluoromethylsulfanyl)methane?
The IUPAC name of 1-butyl-2-methylpiperidine;trifluoro(trifluoromethylsulfanyl)methane (CID 174970526) is 1-butyl-2-methylpiperidine;trifluoro(trifluoromethylsulfanyl)methane.
What is the SMILES notation for 1-butyl-2-methylpiperidine;trifluoro(trifluoromethylsulfanyl)methane?
The canonical SMILES for 1-butyl-2-methylpiperidine;trifluoro(trifluoromethylsulfanyl)methane is CCCCN1CCCCC1C.FC(F)(F)SC(F)(F)F.
What is the InChIKey of 1-butyl-2-methylpiperidine;trifluoro(trifluoromethylsulfanyl)methane?
The InChIKey is NRRGPTFIYIACNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N.C2F6S/c1-3-4-8-11-9-6-5-7-10(11)2;3-1(4,5)9-2(6,7)8/h10H,3-9H2,1-2H3;.
What are the key properties of 1-butyl-2-methylpiperidine;trifluoro(trifluoromethylsulfanyl)methane?
1-butyl-2-methylpiperidine;trifluoro(trifluoromethylsulfanyl)methane has a molecular weight of 325.36 g/mol, XLogP of 5.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-methylpiperidine;trifluoro(trifluoromethylsulfanyl)methane is sourced from PubChem (CID 174970526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).