C19H25N — CID 167639028
1-butyl-2-methylpiperidine;nona-1,3,5,7-tetrayne (PubChem CID 167639028) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 1-butyl-2-methylpiperidine;nona-1,3,5,7-tetrayne.
| Compound Name | 1-butyl-2-methylpiperidine;nona-1,3,5,7-tetrayne |
|---|---|
| PubChem CID | 167639028 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 1-butyl-2-methylpiperidine;nona-1,3,5,7-tetrayne |
| SMILES | C#CC#CC#CC#CC.CCCCN1CCCCC1C |
| InChI | InChI=1S/C10H21N.C9H4/c1-3-4-8-11-9-6-5-7-10(11)2;1-3-5-7-9-8-6-4-2/h10H,3-9H2,1-2H3;1H,2H3 |
| InChIKey | OWYNBWJBWNGKKY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|