C13H26O4 — CID 106668336
5-(3-methoxy-3-methylbutoxy)-2,2-dimethylpentanoic acid (PubChem CID 106668336) has the molecular formula C13H26O4 and a molecular weight of 246.35 g/mol. Its IUPAC name is 5-(3-methoxy-3-methylbutoxy)-2,2-dimethylpentanoic acid.
| Compound Name | 5-(3-methoxy-3-methylbutoxy)-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 106668336 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 5-(3-methoxy-3-methylbutoxy)-2,2-dimethylpentanoic acid |
| SMILES | COC(C)(C)CCOCCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C13H26O4/c1-12(2,11(14)15)7-6-9-17-10-8-13(3,4)16-5/h6-10H2,1-5H3,(H,14,15) |
| InChIKey | ATWWFFCKNYTKIM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|