C13H25NO3 — CID 106204685
2-amino-6-(2-cyclobutylethoxy)-2-methylhexanoic acid (PubChem CID 106204685) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-amino-6-(2-cyclobutylethoxy)-2-methylhexanoic acid.
| Compound Name | 2-amino-6-(2-cyclobutylethoxy)-2-methylhexanoic acid |
|---|---|
| PubChem CID | 106204685 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 2-amino-6-(2-cyclobutylethoxy)-2-methylhexanoic acid |
| SMILES | CC(N)(CCCCOCCC1CCC1)C(=O)O |
| InChI | InChI=1S/C13H25NO3/c1-13(14,12(15)16)8-2-3-9-17-10-7-11-5-4-6-11/h11H,2-10,14H2,1H3,(H,15,16) |
| InChIKey | SCFCLJLMRRMWGW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|