C11H23NO3 — CID 66226341
methyl 2-amino-3-(3,3-dimethylbutoxy)-2-methylpropanoate (PubChem CID 66226341) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is methyl 2-amino-3-(3,3-dimethylbutoxy)-2-methylpropanoate.
| Compound Name | methyl 2-amino-3-(3,3-dimethylbutoxy)-2-methylpropanoate |
|---|---|
| PubChem CID | 66226341 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | methyl 2-amino-3-(3,3-dimethylbutoxy)-2-methylpropanoate |
| SMILES | COC(=O)C(C)(N)COCCC(C)(C)C |
| InChI | InChI=1S/C11H23NO3/c1-10(2,3)6-7-15-8-11(4,12)9(13)14-5/h6-8,12H2,1-5H3 |
| InChIKey | JYWFIHFMKRNEFZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|