C10H20O4 — CID 66234015
3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid (PubChem CID 66234015) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 66234015 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid |
| SMILES | CC(C)(C)CCOCC(C)(O)C(=O)O |
| InChI | InChI=1S/C10H20O4/c1-9(2,3)5-6-14-7-10(4,13)8(11)12/h13H,5-7H2,1-4H3,(H,11,12) |
| InChIKey | QWHGRNRGJPOZPF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|