3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid

C10H20O4 — CID 66234015

IUPAC3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid
SMILESCC(C)(C)CCOCC(C)(O)C(=O)O
InChIInChI=1S/C10H20O4/c1-9(2,3)5-6-14-7-10(4,13)8(11)12/h13H,5-7H2,1-4H3,(H,11,12)
InChIKeyQWHGRNRGJPOZPF-UHFFFAOYSA-N
MW204.27 g/mol
LogP1.27
Rot. Bonds5

About 3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid

3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid (PubChem CID 66234015) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid.

Molecular Properties

Compound Name3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid
PubChem CID66234015
Molecular FormulaC10H20O4
Molecular Weight204.27 g/mol
Exact Mass204.14
IUPAC Name3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid
SMILESCC(C)(C)CCOCC(C)(O)C(=O)O
InChIInChI=1S/C10H20O4/c1-9(2,3)5-6-14-7-10(4,13)8(11)12/h13H,5-7H2,1-4H3,(H,11,12)
InChIKeyQWHGRNRGJPOZPF-UHFFFAOYSA-N
XLogP1.27
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.27
LogP ≤ 51.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid?
The IUPAC name of 3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid (CID 66234015) is 3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid.
What is the SMILES notation for 3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid?
The canonical SMILES for 3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid is CC(C)(C)CCOCC(C)(O)C(=O)O.
What is the InChIKey of 3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid?
The InChIKey is QWHGRNRGJPOZPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4/c1-9(2,3)5-6-14-7-10(4,13)8(11)12/h13H,5-7H2,1-4H3,(H,11,12).
What are the key properties of 3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid?
3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid has a molecular weight of 204.27 g/mol, XLogP of 1.27, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-dimethylbutoxy)-2-hydroxy-2-methylpropanoic acid is sourced from PubChem (CID 66234015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).