C10H18F3NO3 — CID 106487872
methyl 2-(aminomethyl)-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoate (PubChem CID 106487872) has the molecular formula C10H18F3NO3 and a molecular weight of 257.25 g/mol. Its IUPAC name is methyl 2-(aminomethyl)-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoate.
| Compound Name | methyl 2-(aminomethyl)-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoate |
|---|---|
| PubChem CID | 106487872 |
| Molecular Formula | C10H18F3NO3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | methyl 2-(aminomethyl)-2-methyl-5-(2,2,2-trifluoroethoxy)pentanoate |
| SMILES | COC(=O)C(C)(CN)CCCOCC(F)(F)F |
| InChI | InChI=1S/C10H18F3NO3/c1-9(6-14,8(15)16-2)4-3-5-17-7-10(11,12)13/h3-7,14H2,1-2H3 |
| InChIKey | LGTXNQSESYEEFI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|