C14H30N2O4S — CID 79842102
methyl 2-methyl-5-[methyl(2-methylsulfonylethyl)amino]-2-(propylamino)pentanoate (PubChem CID 79842102) has the molecular formula C14H30N2O4S and a molecular weight of 322.47 g/mol. Its IUPAC name is methyl 2-methyl-5-[methyl(2-methylsulfonylethyl)amino]-2-(propylamino)pentanoate.
| Compound Name | methyl 2-methyl-5-[methyl(2-methylsulfonylethyl)amino]-2-(propylamino)pentanoate |
|---|---|
| PubChem CID | 79842102 |
| Molecular Formula | C14H30N2O4S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | methyl 2-methyl-5-[methyl(2-methylsulfonylethyl)amino]-2-(propylamino)pentanoate |
| SMILES | CCCNC(C)(CCCN(C)CCS(C)(=O)=O)C(=O)OC |
| InChI | InChI=1S/C14H30N2O4S/c1-6-9-15-14(2,13(17)20-4)8-7-10-16(3)11-12-21(5,18)19/h15H,6-12H2,1-5H3 |
| InChIKey | YSSTWHSOOCUZED-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |