C12H25N3O2S — CID 79849690
2-methyl-4-[methyl(2-methylsulfonylethyl)amino]-2-(propylamino)butanenitrile (PubChem CID 79849690) has the molecular formula C12H25N3O2S and a molecular weight of 275.42 g/mol. Its IUPAC name is 2-methyl-4-[methyl(2-methylsulfonylethyl)amino]-2-(propylamino)butanenitrile.
| Compound Name | 2-methyl-4-[methyl(2-methylsulfonylethyl)amino]-2-(propylamino)butanenitrile |
|---|---|
| PubChem CID | 79849690 |
| Molecular Formula | C12H25N3O2S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 2-methyl-4-[methyl(2-methylsulfonylethyl)amino]-2-(propylamino)butanenitrile |
| SMILES | CCCNC(C)(C#N)CCN(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C12H25N3O2S/c1-5-7-14-12(2,11-13)6-8-15(3)9-10-18(4,16)17/h14H,5-10H2,1-4H3 |
| InChIKey | UQAHDIPNQIXNIE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |