C13H30N2O3S — CID 79859172
2-methyl-5-[methyl(2-methylsulfonylethyl)amino]-2-(propan-2-ylamino)pentan-1-ol (PubChem CID 79859172) has the molecular formula C13H30N2O3S and a molecular weight of 294.46 g/mol. Its IUPAC name is 2-methyl-5-[methyl(2-methylsulfonylethyl)amino]-2-(propan-2-ylamino)pentan-1-ol.
| Compound Name | 2-methyl-5-[methyl(2-methylsulfonylethyl)amino]-2-(propan-2-ylamino)pentan-1-ol |
|---|---|
| PubChem CID | 79859172 |
| Molecular Formula | C13H30N2O3S |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | 2-methyl-5-[methyl(2-methylsulfonylethyl)amino]-2-(propan-2-ylamino)pentan-1-ol |
| SMILES | CC(C)NC(C)(CO)CCCN(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C13H30N2O3S/c1-12(2)14-13(3,11-16)7-6-8-15(4)9-10-19(5,17)18/h12,14,16H,6-11H2,1-5H3 |
| InChIKey | DKDPRIVCLBHVDE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |