C15H31NO3 — CID 114208529
5-(2-ethylbutoxy)-2-methyl-2-(propylamino)pentanoic acid (PubChem CID 114208529) has the molecular formula C15H31NO3 and a molecular weight of 273.42 g/mol. Its IUPAC name is 5-(2-ethylbutoxy)-2-methyl-2-(propylamino)pentanoic acid.
| Compound Name | 5-(2-ethylbutoxy)-2-methyl-2-(propylamino)pentanoic acid |
|---|---|
| PubChem CID | 114208529 |
| Molecular Formula | C15H31NO3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.23 |
| IUPAC Name | 5-(2-ethylbutoxy)-2-methyl-2-(propylamino)pentanoic acid |
| SMILES | CCCNC(C)(CCCOCC(CC)CC)C(=O)O |
| InChI | InChI=1S/C15H31NO3/c1-5-10-16-15(4,14(17)18)9-8-11-19-12-13(6-2)7-3/h13,16H,5-12H2,1-4H3,(H,17,18) |
| InChIKey | PZQWIIURFXEMBJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|