C16H33NO3 — CID 106806801
2-ethyl-5-(2-ethylhexoxy)-2-(methylamino)pentanoic acid (PubChem CID 106806801) has the molecular formula C16H33NO3 and a molecular weight of 287.44 g/mol. Its IUPAC name is 2-ethyl-5-(2-ethylhexoxy)-2-(methylamino)pentanoic acid.
| Compound Name | 2-ethyl-5-(2-ethylhexoxy)-2-(methylamino)pentanoic acid |
|---|---|
| PubChem CID | 106806801 |
| Molecular Formula | C16H33NO3 |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.25 |
| IUPAC Name | 2-ethyl-5-(2-ethylhexoxy)-2-(methylamino)pentanoic acid |
| SMILES | CCCCC(CC)COCCCC(CC)(NC)C(=O)O |
| InChI | InChI=1S/C16H33NO3/c1-5-8-10-14(6-2)13-20-12-9-11-16(7-3,17-4)15(18)19/h14,17H,5-13H2,1-4H3,(H,18,19) |
| InChIKey | ZHGHFGIZJPCBDK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|