C10H19F2NO3 — CID 106807139
5-(2,2-difluoroethoxy)-2-ethyl-2-(methylamino)pentanoic acid (PubChem CID 106807139) has the molecular formula C10H19F2NO3 and a molecular weight of 239.26 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)-2-ethyl-2-(methylamino)pentanoic acid.
| Compound Name | 5-(2,2-difluoroethoxy)-2-ethyl-2-(methylamino)pentanoic acid |
|---|---|
| PubChem CID | 106807139 |
| Molecular Formula | C10H19F2NO3 |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 5-(2,2-difluoroethoxy)-2-ethyl-2-(methylamino)pentanoic acid |
| SMILES | CCC(CCCOCC(F)F)(NC)C(=O)O |
| InChI | InChI=1S/C10H19F2NO3/c1-3-10(13-2,9(14)15)5-4-6-16-7-8(11)12/h8,13H,3-7H2,1-2H3,(H,14,15) |
| InChIKey | RKEKSQOVQZKXBN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|