C12H23F2NO3 — CID 106807136
5-(2,2-difluoroethoxy)-2-ethyl-2-(propan-2-ylamino)pentanoic acid (PubChem CID 106807136) has the molecular formula C12H23F2NO3 and a molecular weight of 267.32 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)-2-ethyl-2-(propan-2-ylamino)pentanoic acid.
| Compound Name | 5-(2,2-difluoroethoxy)-2-ethyl-2-(propan-2-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 106807136 |
| Molecular Formula | C12H23F2NO3 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 5-(2,2-difluoroethoxy)-2-ethyl-2-(propan-2-ylamino)pentanoic acid |
| SMILES | CCC(CCCOCC(F)F)(NC(C)C)C(=O)O |
| InChI | InChI=1S/C12H23F2NO3/c1-4-12(11(16)17,15-9(2)3)6-5-7-18-8-10(13)14/h9-10,15H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | SFVABNUWDCXAPP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|