C9H16F3NO2 — CID 63227923
2-methyl-2-(3,3,3-trifluoropropylamino)pentanoic acid (PubChem CID 63227923) has the molecular formula C9H16F3NO2 and a molecular weight of 227.23 g/mol. Its IUPAC name is 2-methyl-2-(3,3,3-trifluoropropylamino)pentanoic acid.
| Compound Name | 2-methyl-2-(3,3,3-trifluoropropylamino)pentanoic acid |
|---|---|
| PubChem CID | 63227923 |
| Molecular Formula | C9H16F3NO2 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-methyl-2-(3,3,3-trifluoropropylamino)pentanoic acid |
| SMILES | CCCC(C)(NCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H16F3NO2/c1-3-4-8(2,7(14)15)13-6-5-9(10,11)12/h13H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | GRTWHXNKOOHBRO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |