2-methyl-2-(2-methylpropylamino)pentanoic acid

C10H21NO2 — CID 43619509

IUPAC2-methyl-2-(2-methylpropylamino)pentanoic acid
SMILESCCCC(C)(NCC(C)C)C(=O)O
InChIInChI=1S/C10H21NO2/c1-5-6-10(4,9(12)13)11-7-8(2)3/h8,11H,5-7H2,1-4H3,(H,12,13)
InChIKeyGIGVSLCSUYQMBG-UHFFFAOYSA-N
MW187.28 g/mol
LogP1.88
Rot. Bonds6

About 2-methyl-2-(2-methylpropylamino)pentanoic acid

2-methyl-2-(2-methylpropylamino)pentanoic acid (PubChem CID 43619509) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is 2-methyl-2-(2-methylpropylamino)pentanoic acid.

Molecular Properties

Compound Name2-methyl-2-(2-methylpropylamino)pentanoic acid
PubChem CID43619509
Molecular FormulaC10H21NO2
Molecular Weight187.28 g/mol
Exact Mass187.16
IUPAC Name2-methyl-2-(2-methylpropylamino)pentanoic acid
SMILESCCCC(C)(NCC(C)C)C(=O)O
InChIInChI=1S/C10H21NO2/c1-5-6-10(4,9(12)13)11-7-8(2)3/h8,11H,5-7H2,1-4H3,(H,12,13)
InChIKeyGIGVSLCSUYQMBG-UHFFFAOYSA-N
XLogP1.88
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.28
LogP ≤ 51.88
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-methyl-2-(2-methylpropylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-methyl-2-(3-methylbutylamino)pentanoic acid
CID 43619536
2-(2,3-dihydroxypropylamino)-2-methylpentanoic acid
CID 82851075
2,4-dimethyl-2-(2-methylpropylamino)pentanoic acid
CID 61001424
2-[(3-hydroxy-3-methylbutyl)amino]-2-methylpentanoic acid
CID 79355808
2-methyl-2-(2-methylpentanoylamino)pentanoic acid
CID 43619107
2-methyl-2-(3,3,3-trifluoropropylamino)pentanoic acid
CID 63227923
2-methyl-2-(2-methylbutanoylamino)pentanoic acid
CID 43618557
2-(2,2-dihydroxyethylamino)-2-methyltetradecanoic acid
CID 151765471
2-(2-ethylsulfonylethylamino)-2-methylpentanoic acid
CID 43808028
2-(2,3-dimethylpentanoylamino)-2-methylpentanoic acid
CID 120517032
2-methyl-2-(2-methylbutan-2-ylamino)pentanoic acid
CID 114987745
2-formamido-2-methylpentanoic acid
CID 61145661

Frequently Asked Questions

What is the IUPAC name of 2-methyl-2-(2-methylpropylamino)pentanoic acid?
The IUPAC name of 2-methyl-2-(2-methylpropylamino)pentanoic acid (CID 43619509) is 2-methyl-2-(2-methylpropylamino)pentanoic acid.
What is the SMILES notation for 2-methyl-2-(2-methylpropylamino)pentanoic acid?
The canonical SMILES for 2-methyl-2-(2-methylpropylamino)pentanoic acid is CCCC(C)(NCC(C)C)C(=O)O.
What is the InChIKey of 2-methyl-2-(2-methylpropylamino)pentanoic acid?
The InChIKey is GIGVSLCSUYQMBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-5-6-10(4,9(12)13)11-7-8(2)3/h8,11H,5-7H2,1-4H3,(H,12,13).
What are the key properties of 2-methyl-2-(2-methylpropylamino)pentanoic acid?
2-methyl-2-(2-methylpropylamino)pentanoic acid has a molecular weight of 187.28 g/mol, XLogP of 1.88, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(2-methylpropylamino)pentanoic acid is sourced from PubChem (CID 43619509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).