2-methyl-2-(2-methylbutan-2-ylamino)pentanoic acid

C11H23NO2 — CID 114987745

IUPAC2-methyl-2-(2-methylbutan-2-ylamino)pentanoic acid
SMILESCCCC(C)(NC(C)(C)CC)C(=O)O
InChIInChI=1S/C11H23NO2/c1-6-8-11(5,9(13)14)12-10(3,4)7-2/h12H,6-8H2,1-5H3,(H,13,14)
InChIKeyRLPOHJVEHRSHCL-UHFFFAOYSA-N
MW201.31 g/mol
LogP2.41
Rot. Bonds6

About 2-methyl-2-(2-methylbutan-2-ylamino)pentanoic acid

2-methyl-2-(2-methylbutan-2-ylamino)pentanoic acid (PubChem CID 114987745) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-methyl-2-(2-methylbutan-2-ylamino)pentanoic acid.

Molecular Properties

Compound Name2-methyl-2-(2-methylbutan-2-ylamino)pentanoic acid
PubChem CID114987745
Molecular FormulaC11H23NO2
Molecular Weight201.31 g/mol
Exact Mass201.17
IUPAC Name2-methyl-2-(2-methylbutan-2-ylamino)pentanoic acid
SMILESCCCC(C)(NC(C)(C)CC)C(=O)O
InChIInChI=1S/C11H23NO2/c1-6-8-11(5,9(13)14)12-10(3,4)7-2/h12H,6-8H2,1-5H3,(H,13,14)
InChIKeyRLPOHJVEHRSHCL-UHFFFAOYSA-N
XLogP2.41
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.31
LogP ≤ 52.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-methyl-2-(2-methylbutan-2-ylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-formamido-2-methylpentanoic acid
CID 61145661
2-[(2-amino-2-methylbutanoyl)amino]-2-methylpentanoic acid
CID 79805177
2-methyl-2-(2-methylpropylamino)pentanoic acid
CID 43619509
2-[(2-aminoacetyl)amino]-2-methylpentanoic acid
CID 61159879
2-[(3-hydroxy-3-methylbutyl)amino]-2-methylpentanoic acid
CID 79355808
2-methyl-2-(2-methylbutanoylamino)pentanoic acid
CID 43618557
2-methyl-2-(3,3,3-trifluoropropylamino)pentanoic acid
CID 63227923
2-[[2-(tert-butylamino)acetyl]amino]-2-methylpentanoic acid
CID 79256791
2-anilino-2-methylpentanoic acid
CID 60992039
(2S)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid
CID 39870673
2-(2,3-dihydroxypropylamino)-2-methylpentanoic acid
CID 82851075
2-(2-ethylsulfonylethylamino)-2-methylpentanoic acid
CID 43808028

Frequently Asked Questions

What is the IUPAC name of 2-methyl-2-(2-methylbutan-2-ylamino)pentanoic acid?
The IUPAC name of 2-methyl-2-(2-methylbutan-2-ylamino)pentanoic acid (CID 114987745) is 2-methyl-2-(2-methylbutan-2-ylamino)pentanoic acid.
What is the SMILES notation for 2-methyl-2-(2-methylbutan-2-ylamino)pentanoic acid?
The canonical SMILES for 2-methyl-2-(2-methylbutan-2-ylamino)pentanoic acid is CCCC(C)(NC(C)(C)CC)C(=O)O.
What is the InChIKey of 2-methyl-2-(2-methylbutan-2-ylamino)pentanoic acid?
The InChIKey is RLPOHJVEHRSHCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-6-8-11(5,9(13)14)12-10(3,4)7-2/h12H,6-8H2,1-5H3,(H,13,14).
What are the key properties of 2-methyl-2-(2-methylbutan-2-ylamino)pentanoic acid?
2-methyl-2-(2-methylbutan-2-ylamino)pentanoic acid has a molecular weight of 201.31 g/mol, XLogP of 2.41, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(2-methylbutan-2-ylamino)pentanoic acid is sourced from PubChem (CID 114987745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).