C14H30N2O4 — CID 104565452
2-(ethylamino)-6-[2-(2-methoxyethoxy)ethoxy]-2-methylhexanamide (PubChem CID 104565452) has the molecular formula C14H30N2O4 and a molecular weight of 290.40 g/mol. Its IUPAC name is 2-(ethylamino)-6-[2-(2-methoxyethoxy)ethoxy]-2-methylhexanamide.
| Compound Name | 2-(ethylamino)-6-[2-(2-methoxyethoxy)ethoxy]-2-methylhexanamide |
|---|---|
| PubChem CID | 104565452 |
| Molecular Formula | C14H30N2O4 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2-(ethylamino)-6-[2-(2-methoxyethoxy)ethoxy]-2-methylhexanamide |
| SMILES | CCNC(C)(CCCCOCCOCCOC)C(N)=O |
| InChI | InChI=1S/C14H30N2O4/c1-4-16-14(2,13(15)17)7-5-6-8-19-11-12-20-10-9-18-3/h16H,4-12H2,1-3H3,(H2,15,17) |
| InChIKey | IWONAEDDTULJNE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|