C16H25FN2O2 — CID 102983576
5-(5-fluoro-2-methylphenoxy)-2-methyl-2-(propylamino)pentanamide (PubChem CID 102983576) has the molecular formula C16H25FN2O2 and a molecular weight of 296.39 g/mol. Its IUPAC name is 5-(5-fluoro-2-methylphenoxy)-2-methyl-2-(propylamino)pentanamide.
| Compound Name | 5-(5-fluoro-2-methylphenoxy)-2-methyl-2-(propylamino)pentanamide |
|---|---|
| PubChem CID | 102983576 |
| Molecular Formula | C16H25FN2O2 |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 5-(5-fluoro-2-methylphenoxy)-2-methyl-2-(propylamino)pentanamide |
| SMILES | CCCNC(C)(CCCOc1cc(F)ccc1C)C(N)=O |
| InChI | InChI=1S/C16H25FN2O2/c1-4-9-19-16(3,15(18)20)8-5-10-21-14-11-13(17)7-6-12(14)2/h6-7,11,19H,4-5,8-10H2,1-3H3,(H2,18,20) |
| InChIKey | IESGCACVHHJINI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|