C12H26N4O2 — CID 66221079
2-methyl-6-(methylamino)-2-(propylamino)heptanediamide (PubChem CID 66221079) has the molecular formula C12H26N4O2 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-methyl-6-(methylamino)-2-(propylamino)heptanediamide.
| Compound Name | 2-methyl-6-(methylamino)-2-(propylamino)heptanediamide |
|---|---|
| PubChem CID | 66221079 |
| Molecular Formula | C12H26N4O2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 2-methyl-6-(methylamino)-2-(propylamino)heptanediamide |
| SMILES | CCCNC(C)(CCCC(NC)C(N)=O)C(N)=O |
| InChI | InChI=1S/C12H26N4O2/c1-4-8-16-12(2,11(14)18)7-5-6-9(15-3)10(13)17/h9,15-16H,4-8H2,1-3H3,(H2,13,17)(H2,14,18) |
| InChIKey | MSAWEOWCFQDOID-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |