C10H21N3O3 — CID 66223013
7-amino-2-methyl-2,6-bis(methylamino)-7-oxoheptanoic acid (PubChem CID 66223013) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is 7-amino-2-methyl-2,6-bis(methylamino)-7-oxoheptanoic acid.
| Compound Name | 7-amino-2-methyl-2,6-bis(methylamino)-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 66223013 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 7-amino-2-methyl-2,6-bis(methylamino)-7-oxoheptanoic acid |
| SMILES | CNC(CCCC(C)(NC)C(=O)O)C(N)=O |
| InChI | InChI=1S/C10H21N3O3/c1-10(13-3,9(15)16)6-4-5-7(12-2)8(11)14/h7,12-13H,4-6H2,1-3H3,(H2,11,14)(H,15,16) |
| InChIKey | MEPVOTXPBCEVRO-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |