C16H36N4O — CID 103191019
5-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methyl-2-(propylamino)pentanamide (PubChem CID 103191019) has the molecular formula C16H36N4O and a molecular weight of 300.49 g/mol. Its IUPAC name is 5-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methyl-2-(propylamino)pentanamide.
| Compound Name | 5-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methyl-2-(propylamino)pentanamide |
|---|---|
| PubChem CID | 103191019 |
| Molecular Formula | C16H36N4O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.29 |
| IUPAC Name | 5-[1-(dimethylamino)propan-2-yl-ethylamino]-2-methyl-2-(propylamino)pentanamide |
| SMILES | CCCNC(C)(CCCN(CC)C(C)CN(C)C)C(N)=O |
| InChI | InChI=1S/C16H36N4O/c1-7-11-18-16(4,15(17)21)10-9-12-20(8-2)14(3)13-19(5)6/h14,18H,7-13H2,1-6H3,(H2,17,21) |
| InChIKey | UNSOLQORPKTQCG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |