C13H29N3O2 — CID 64710690
4-[2-methoxyethyl(methyl)amino]-2-methyl-2-(propylamino)pentanamide (PubChem CID 64710690) has the molecular formula C13H29N3O2 and a molecular weight of 259.39 g/mol. Its IUPAC name is 4-[2-methoxyethyl(methyl)amino]-2-methyl-2-(propylamino)pentanamide.
| Compound Name | 4-[2-methoxyethyl(methyl)amino]-2-methyl-2-(propylamino)pentanamide |
|---|---|
| PubChem CID | 64710690 |
| Molecular Formula | C13H29N3O2 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 4-[2-methoxyethyl(methyl)amino]-2-methyl-2-(propylamino)pentanamide |
| SMILES | CCCNC(C)(CC(C)N(C)CCOC)C(N)=O |
| InChI | InChI=1S/C13H29N3O2/c1-6-7-15-13(3,12(14)17)10-11(2)16(4)8-9-18-5/h11,15H,6-10H2,1-5H3,(H2,14,17) |
| InChIKey | LFZKJTGWOFNISF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |