C12H26N2OS — CID 64709561
2-methyl-4-propan-2-ylsulfanyl-2-(propylamino)pentanamide (PubChem CID 64709561) has the molecular formula C12H26N2OS and a molecular weight of 246.42 g/mol. Its IUPAC name is 2-methyl-4-propan-2-ylsulfanyl-2-(propylamino)pentanamide.
| Compound Name | 2-methyl-4-propan-2-ylsulfanyl-2-(propylamino)pentanamide |
|---|---|
| PubChem CID | 64709561 |
| Molecular Formula | C12H26N2OS |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 2-methyl-4-propan-2-ylsulfanyl-2-(propylamino)pentanamide |
| SMILES | CCCNC(C)(CC(C)SC(C)C)C(N)=O |
| InChI | InChI=1S/C12H26N2OS/c1-6-7-14-12(5,11(13)15)8-10(4)16-9(2)3/h9-10,14H,6-8H2,1-5H3,(H2,13,15) |
| InChIKey | QRTZEKJYQSNRIX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |