About 4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentanamide
4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentanamide (PubChem CID 102925681) has the molecular formula C16H27N3OS
and a molecular weight of 309.48 g/mol. Its IUPAC name is 4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentanamide.
Molecular Properties
| Compound Name | 4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentanamide |
| PubChem CID | 102925681 |
| Molecular Formula | C16H27N3OS |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentanamide |
| SMILES | CCCNC(C)(CC(C)Sc1cc(C)cc(C)n1)C(N)=O |
| InChI | InChI=1S/C16H27N3OS/c1-6-7-18-16(5,15(17)20)10-13(4)21-14-9-11(2)8-12(3)19-14/h8-9,13,18H,6-7,10H2,1-5H3,(H2,17,20) |
| InChIKey | LEQSICFPCNAQQI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentanamide?
The IUPAC name of 4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentanamide (CID 102925681) is 4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentanamide.
What is the SMILES notation for 4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentanamide?
The canonical SMILES for 4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentanamide is CCCNC(C)(CC(C)Sc1cc(C)cc(C)n1)C(N)=O.
What is the InChIKey of 4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentanamide?
The InChIKey is LEQSICFPCNAQQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3OS/c1-6-7-18-16(5,15(17)20)10-13(4)21-14-9-11(2)8-12(3)19-14/h8-9,13,18H,6-7,10H2,1-5H3,(H2,17,20).
What are the key properties of 4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentanamide?
4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentanamide has a molecular weight of 309.48 g/mol, XLogP of 2.81, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentanamide is sourced from PubChem (CID 102925681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).