C15H22F2N2OS — CID 64712171
4-(3,4-difluorophenyl)sulfanyl-2-methyl-2-(propylamino)pentanamide (PubChem CID 64712171) has the molecular formula C15H22F2N2OS and a molecular weight of 316.42 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)sulfanyl-2-methyl-2-(propylamino)pentanamide.
| Compound Name | 4-(3,4-difluorophenyl)sulfanyl-2-methyl-2-(propylamino)pentanamide |
|---|---|
| PubChem CID | 64712171 |
| Molecular Formula | C15H22F2N2OS |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 4-(3,4-difluorophenyl)sulfanyl-2-methyl-2-(propylamino)pentanamide |
| SMILES | CCCNC(C)(CC(C)Sc1ccc(F)c(F)c1)C(N)=O |
| InChI | InChI=1S/C15H22F2N2OS/c1-4-7-19-15(3,14(18)20)9-10(2)21-11-5-6-12(16)13(17)8-11/h5-6,8,10,19H,4,7,9H2,1-3H3,(H2,18,20) |
| InChIKey | KVMJDLCQIJFNEV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |