C11H12F2O2S — CID 62215056
4-(3,4-difluorophenyl)sulfanylpentanoic acid (PubChem CID 62215056) has the molecular formula C11H12F2O2S and a molecular weight of 246.28 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)sulfanylpentanoic acid.
| Compound Name | 4-(3,4-difluorophenyl)sulfanylpentanoic acid |
|---|---|
| PubChem CID | 62215056 |
| Molecular Formula | C11H12F2O2S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 4-(3,4-difluorophenyl)sulfanylpentanoic acid |
| SMILES | CC(CCC(=O)O)Sc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H12F2O2S/c1-7(2-5-11(14)15)16-8-3-4-9(12)10(13)6-8/h3-4,6-7H,2,5H2,1H3,(H,14,15) |
| InChIKey | CBKHWCOEZQAGOA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |