C11H14F2N2OS — CID 63582881
4-(3,4-difluorophenyl)sulfanylpentanehydrazide (PubChem CID 63582881) has the molecular formula C11H14F2N2OS and a molecular weight of 260.31 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)sulfanylpentanehydrazide.
| Compound Name | 4-(3,4-difluorophenyl)sulfanylpentanehydrazide |
|---|---|
| PubChem CID | 63582881 |
| Molecular Formula | C11H14F2N2OS |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 4-(3,4-difluorophenyl)sulfanylpentanehydrazide |
| SMILES | CC(CCC(=O)NN)Sc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H14F2N2OS/c1-7(2-5-11(16)15-14)17-8-3-4-9(12)10(13)6-8/h3-4,6-7H,2,5,14H2,1H3,(H,15,16) |
| InChIKey | ITHKKKKZWAVVRH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|